C14H20N2O2 — CID 142444899
8-[(2E)-2-ethenylpenta-2,4-dienyl]-6,7,9,9a-tetrahydro-1H-pyrazino[2,1-c][1,4]oxazin-4-one (PubChem CID 142444899) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 8-[(2E)-2-ethenylpenta-2,4-dienyl]-6,7,9,9a-tetrahydro-1H-pyrazino[2,1-c][1,4]oxazin-4-one.
| Compound Name | 8-[(2E)-2-ethenylpenta-2,4-dienyl]-6,7,9,9a-tetrahydro-1H-pyrazino[2,1-c][1,4]oxazin-4-one |
|---|---|
| PubChem CID | 142444899 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 8-[(2E)-2-ethenylpenta-2,4-dienyl]-6,7,9,9a-tetrahydro-1H-pyrazino[2,1-c][1,4]oxazin-4-one |
| SMILES | C=C/C=C(\C=C)CN1CCN2C(=O)COCC2C1 |
| InChI | InChI=1S/C14H20N2O2/c1-3-5-12(4-2)8-15-6-7-16-13(9-15)10-18-11-14(16)17/h3-5,13H,1-2,6-11H2/b12-5+ |
| InChIKey | KUSSSUJRZNRATH-LFYBBSHMSA-N |
| XLogP | 0.83 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|