C25H26F3N7O — CID 142445183
[(3S)-3,4-dimethylpiperazin-1-yl]-[7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-8,9,10,11-tetrahydro-3H-pyrazolo[4,3-a]phenanthridin-1-yl]methanone (PubChem CID 142445183) has the molecular formula C25H26F3N7O and a molecular weight of 497.53 g/mol. Its IUPAC name is [(3S)-3,4-dimethylpiperazin-1-yl]-[7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-8,9,10,11-tetrahydro-3H-pyrazolo[4,3-a]phenanthridin-1-yl]methanone.
| Compound Name | [(3S)-3,4-dimethylpiperazin-1-yl]-[7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-8,9,10,11-tetrahydro-3H-pyrazolo[4,3-a]phenanthridin-1-yl]methanone |
|---|---|
| PubChem CID | 142445183 |
| Molecular Formula | C25H26F3N7O |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | [(3S)-3,4-dimethylpiperazin-1-yl]-[7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-8,9,10,11-tetrahydro-3H-pyrazolo[4,3-a]phenanthridin-1-yl]methanone |
| SMILES | C[C@H]1CN(C(=O)c2n[nH]c3ccc4nc(-c5cn[nH]c5C(F)(F)F)c5c(c4c23)CCCC5)CCN1C |
| InChI | InChI=1S/C25H26F3N7O/c1-13-12-35(10-9-34(13)2)24(36)22-20-18(31-32-22)8-7-17-19(20)14-5-3-4-6-15(14)21(30-17)16-11-29-33-23(16)25(26,27)28/h7-8,11,13H,3-6,9-10,12H2,1-2H3,(H,29,33)(H,31,32)/t13-/m0/s1 |
| InChIKey | OFGSWPYWKHKYIV-ZDUSSCGKSA-N |
| XLogP | 4.17 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |