C28H32N6 — CID 142445263
2-methanimidoyl-4-[2-[(4-methylpiperazin-1-yl)methyl]-8,9,10,11-tetrahydro-3H-pyrrolo[3,2-a]phenanthridin-7-yl]aniline (PubChem CID 142445263) has the molecular formula C28H32N6 and a molecular weight of 452.61 g/mol. Its IUPAC name is 2-methanimidoyl-4-[2-[(4-methylpiperazin-1-yl)methyl]-8,9,10,11-tetrahydro-3H-pyrrolo[3,2-a]phenanthridin-7-yl]aniline.
| Compound Name | 2-methanimidoyl-4-[2-[(4-methylpiperazin-1-yl)methyl]-8,9,10,11-tetrahydro-3H-pyrrolo[3,2-a]phenanthridin-7-yl]aniline |
|---|---|
| PubChem CID | 142445263 |
| Molecular Formula | C28H32N6 |
| Molecular Weight | 452.61 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 2-methanimidoyl-4-[2-[(4-methylpiperazin-1-yl)methyl]-8,9,10,11-tetrahydro-3H-pyrrolo[3,2-a]phenanthridin-7-yl]aniline |
| SMILES | [H]/N=C/c1cc(-c2nc3ccc4[nH]c(CN5CCN(C)CC5)cc4c3c3c2CCCC3)ccc1N |
| InChI | InChI=1S/C28H32N6/c1-33-10-12-34(13-11-33)17-20-15-23-25(31-20)8-9-26-27(23)21-4-2-3-5-22(21)28(32-26)18-6-7-24(30)19(14-18)16-29/h6-9,14-16,29,31H,2-5,10-13,17,30H2,1H3/b29-16+ |
| InChIKey | YINBRJPGCFVCJQ-MUFRIFMGSA-N |
| XLogP | 4.59 |
| TPSA | 85.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.61 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|