C34H33F3N6O2 — CID 142445491
7-(4-hydroxyphenyl)-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridine-9-carboxamide (PubChem CID 142445491) has the molecular formula C34H33F3N6O2 and a molecular weight of 614.67 g/mol. Its IUPAC name is 7-(4-hydroxyphenyl)-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridine-9-carboxamide.
| Compound Name | 7-(4-hydroxyphenyl)-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridine-9-carboxamide |
|---|---|
| PubChem CID | 142445491 |
| Molecular Formula | C34H33F3N6O2 |
| Molecular Weight | 614.67 g/mol |
| Exact Mass | 614.26 |
| IUPAC Name | 7-(4-hydroxyphenyl)-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridine-9-carboxamide |
| SMILES | CN1CCN(Cc2ccc(NC(=O)C3CCc4c(c(-c5ccc(O)cc5)nc5ccc6[nH]ncc6c45)C3)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C34H33F3N6O2/c1-42-12-14-43(15-13-42)19-22-2-6-23(17-28(22)34(35,36)37)39-33(45)21-5-9-25-26(16-21)32(20-3-7-24(44)8-4-20)40-30-11-10-29-27(31(25)30)18-38-41-29/h2-4,6-8,10-11,17-18,21,44H,5,9,12-16,19H2,1H3,(H,38,41)(H,39,45) |
| InChIKey | ABEBSXVMGOYFOP-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.67 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |