C17H18FN5 — CID 142445540
6-[(E)-1-amino-3-iminoprop-1-en-2-yl]-4-fluoro-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridin-2-amine (PubChem CID 142445540) has the molecular formula C17H18FN5 and a molecular weight of 311.36 g/mol. Its IUPAC name is 6-[(E)-1-amino-3-iminoprop-1-en-2-yl]-4-fluoro-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridin-2-amine.
| Compound Name | 6-[(E)-1-amino-3-iminoprop-1-en-2-yl]-4-fluoro-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridin-2-amine |
|---|---|
| PubChem CID | 142445540 |
| Molecular Formula | C17H18FN5 |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 6-[(E)-1-amino-3-iminoprop-1-en-2-yl]-4-fluoro-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridin-2-amine |
| SMILES | [H]/N=C/C(=C\N)c1nc2c(F)cc(N)c(/C=N/[H])c2c2c1CCCC2 |
| InChI | InChI=1S/C17H18FN5/c18-13-5-14(22)12(8-21)15-10-3-1-2-4-11(10)16(23-17(13)15)9(6-19)7-20/h5-8,19,21H,1-4,20,22H2/b9-7+,19-6+,21-8+ |
| InChIKey | WYDWMCJJWMUHOJ-XMWMNLADSA-N |
| XLogP | 2.78 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|