C25H30N4O — CID 142445544
4-[2-amino-1-[2-(diethylamino)ethanimidoyl]-7,8,9,10-tetrahydrophenanthridin-6-yl]phenol (PubChem CID 142445544) has the molecular formula C25H30N4O and a molecular weight of 402.54 g/mol. Its IUPAC name is 4-[2-amino-1-[2-(diethylamino)ethanimidoyl]-7,8,9,10-tetrahydrophenanthridin-6-yl]phenol.
| Compound Name | 4-[2-amino-1-[2-(diethylamino)ethanimidoyl]-7,8,9,10-tetrahydrophenanthridin-6-yl]phenol |
|---|---|
| PubChem CID | 142445544 |
| Molecular Formula | C25H30N4O |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 4-[2-amino-1-[2-(diethylamino)ethanimidoyl]-7,8,9,10-tetrahydrophenanthridin-6-yl]phenol |
| SMILES | [H]/N=C(\CN(CC)CC)c1c(N)ccc2nc(-c3ccc(O)cc3)c3c(c12)CCCC3 |
| InChI | InChI=1S/C25H30N4O/c1-3-29(4-2)15-21(27)24-20(26)13-14-22-23(24)18-7-5-6-8-19(18)25(28-22)16-9-11-17(30)12-10-16/h9-14,27,30H,3-8,15,26H2,1-2H3/b27-21+ |
| InChIKey | VFMNHCGHQYJLNP-SZXQPVLSSA-N |
| XLogP | 4.78 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|