C19H18N4O — CID 142445654
4-(4-amino-3-diazenyl-7,8,9,10-tetrahydrophenanthridin-6-yl)phenol (PubChem CID 142445654) has the molecular formula C19H18N4O and a molecular weight of 318.38 g/mol. Its IUPAC name is 4-(4-amino-3-diazenyl-7,8,9,10-tetrahydrophenanthridin-6-yl)phenol.
| Compound Name | 4-(4-amino-3-diazenyl-7,8,9,10-tetrahydrophenanthridin-6-yl)phenol |
|---|---|
| PubChem CID | 142445654 |
| Molecular Formula | C19H18N4O |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 4-(4-amino-3-diazenyl-7,8,9,10-tetrahydrophenanthridin-6-yl)phenol |
| SMILES | [H]/N=N/c1ccc2c3c(c(-c4ccc(O)cc4)nc2c1N)CCCC3 |
| InChI | InChI=1S/C19H18N4O/c20-17-16(23-21)10-9-15-13-3-1-2-4-14(13)18(22-19(15)17)11-5-7-12(24)8-6-11/h5-10,21,24H,1-4,20H2/b23-21+ |
| InChIKey | GVQLZGXWPJGHPN-XTQSDGFTSA-N |
| XLogP | 4.73 |
| TPSA | 95.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|