C20H27N5 — CID 142445734
1-methanimidoyl-6-[4-(methylamino)piperidin-1-yl]-7,8,9,10-tetrahydrophenanthridin-2-amine (PubChem CID 142445734) has the molecular formula C20H27N5 and a molecular weight of 337.47 g/mol. Its IUPAC name is 1-methanimidoyl-6-[4-(methylamino)piperidin-1-yl]-7,8,9,10-tetrahydrophenanthridin-2-amine.
| Compound Name | 1-methanimidoyl-6-[4-(methylamino)piperidin-1-yl]-7,8,9,10-tetrahydrophenanthridin-2-amine |
|---|---|
| PubChem CID | 142445734 |
| Molecular Formula | C20H27N5 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 1-methanimidoyl-6-[4-(methylamino)piperidin-1-yl]-7,8,9,10-tetrahydrophenanthridin-2-amine |
| SMILES | [H]/N=C/c1c(N)ccc2nc(N3CCC(NC)CC3)c3c(c12)CCCC3 |
| InChI | InChI=1S/C20H27N5/c1-23-13-8-10-25(11-9-13)20-15-5-3-2-4-14(15)19-16(12-21)17(22)6-7-18(19)24-20/h6-7,12-13,21,23H,2-5,8-11,22H2,1H3/b21-12+ |
| InChIKey | DHJWUYFCSGXGTB-CIAFOILYSA-N |
| XLogP | 2.88 |
| TPSA | 78.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|