C23H25N3O3 — CID 142445744
2-amino-6-(4-hydroxyphenyl)-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridine-8-carboxylic acid;ethane (PubChem CID 142445744) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 2-amino-6-(4-hydroxyphenyl)-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridine-8-carboxylic acid;ethane.
| Compound Name | 2-amino-6-(4-hydroxyphenyl)-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridine-8-carboxylic acid;ethane |
|---|---|
| PubChem CID | 142445744 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 2-amino-6-(4-hydroxyphenyl)-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridine-8-carboxylic acid;ethane |
| SMILES | CC.[H]/N=C/c1c(N)ccc2nc(-c3ccc(O)cc3)c3c(c12)CCC(C(=O)O)C3 |
| InChI | InChI=1S/C21H19N3O3.C2H6/c22-10-16-17(23)7-8-18-19(16)14-6-3-12(21(26)27)9-15(14)20(24-18)11-1-4-13(25)5-2-11;1-2/h1-2,4-5,7-8,10,12,22,25H,3,6,9,23H2,(H,26,27);1-2H3/b22-10+; |
| InChIKey | VQYFMQRFIMTXIQ-UAONINCZSA-N |
| XLogP | 4.40 |
| TPSA | 120.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|