About 4-[9-(4-methylpiperazin-1-yl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol
4-[9-(4-methylpiperazin-1-yl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol (PubChem CID 142445901) has the molecular formula C21H21N5O
and a molecular weight of 359.43 g/mol. Its IUPAC name is 4-[9-(4-methylpiperazin-1-yl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol.
Molecular Properties
| Compound Name | 4-[9-(4-methylpiperazin-1-yl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol |
| PubChem CID | 142445901 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 4-[9-(4-methylpiperazin-1-yl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol |
| SMILES | CN1CCN(c2cc(-c3ccc(O)cc3)nc3ccc4[nH]ncc4c23)CC1 |
| InChI | InChI=1S/C21H21N5O/c1-25-8-10-26(11-9-25)20-12-19(14-2-4-15(27)5-3-14)23-18-7-6-17-16(21(18)20)13-22-24-17/h2-7,12-13,27H,8-11H2,1H3,(H,22,24) |
| InChIKey | KVSCYBVAQKMHIY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[9-(4-methylpiperazin-1-yl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[9-(4-methylpiperazin-1-yl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol?
The IUPAC name of 4-[9-(4-methylpiperazin-1-yl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol (CID 142445901) is 4-[9-(4-methylpiperazin-1-yl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol.
What is the SMILES notation for 4-[9-(4-methylpiperazin-1-yl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol?
The canonical SMILES for 4-[9-(4-methylpiperazin-1-yl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol is CN1CCN(c2cc(-c3ccc(O)cc3)nc3ccc4[nH]ncc4c23)CC1.
What is the InChIKey of 4-[9-(4-methylpiperazin-1-yl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol?
The InChIKey is KVSCYBVAQKMHIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N5O/c1-25-8-10-26(11-9-25)20-12-19(14-2-4-15(27)5-3-14)23-18-7-6-17-16(21(18)20)13-22-24-17/h2-7,12-13,27H,8-11H2,1H3,(H,22,24).
What are the key properties of 4-[9-(4-methylpiperazin-1-yl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol?
4-[9-(4-methylpiperazin-1-yl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol has a molecular weight of 359.43 g/mol, XLogP of 3.24, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[9-(4-methylpiperazin-1-yl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol is sourced from PubChem (CID 142445901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).