C27H31N3O2 — CID 142445921
2-ethyl-N-[6-(4-hydroxyphenyl)-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridin-2-yl]pentanamide (PubChem CID 142445921) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 2-ethyl-N-[6-(4-hydroxyphenyl)-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridin-2-yl]pentanamide.
| Compound Name | 2-ethyl-N-[6-(4-hydroxyphenyl)-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridin-2-yl]pentanamide |
|---|---|
| PubChem CID | 142445921 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 2-ethyl-N-[6-(4-hydroxyphenyl)-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridin-2-yl]pentanamide |
| SMILES | [H]/N=C/c1c(NC(=O)C(CC)CCC)ccc2nc(-c3ccc(O)cc3)c3c(c12)CCCC3 |
| InChI | InChI=1S/C27H31N3O2/c1-3-7-17(4-2)27(32)30-23-14-15-24-25(22(23)16-28)20-8-5-6-9-21(20)26(29-24)18-10-12-19(31)13-11-18/h10-17,28,31H,3-9H2,1-2H3,(H,30,32)/b28-16+ |
| InChIKey | YZALJSPNLNTBJA-LQKURTRISA-N |
| XLogP | 6.25 |
| TPSA | 86.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|