C36H44FN5O4S — CID 142446683
methyl N-[(1S,2S)-2-[(2-ethylimidazol-1-yl)-[1-[[1-(4-ethynylsulfonylphenyl)azetidin-3-yl]methyl]piperidin-4-yl]-(3-fluorophenyl)methyl]cyclopentyl]carbamate (PubChem CID 142446683) has the molecular formula C36H44FN5O4S and a molecular weight of 661.84 g/mol. Its IUPAC name is methyl N-[(1S,2S)-2-[(2-ethylimidazol-1-yl)-[1-[[1-(4-ethynylsulfonylphenyl)azetidin-3-yl]methyl]piperidin-4-yl]-(3-fluorophenyl)methyl]cyclopentyl]carbamate.
| Compound Name | methyl N-[(1S,2S)-2-[(2-ethylimidazol-1-yl)-[1-[[1-(4-ethynylsulfonylphenyl)azetidin-3-yl]methyl]piperidin-4-yl]-(3-fluorophenyl)methyl]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 142446683 |
| Molecular Formula | C36H44FN5O4S |
| Molecular Weight | 661.84 g/mol |
| Exact Mass | 661.31 |
| IUPAC Name | methyl N-[(1S,2S)-2-[(2-ethylimidazol-1-yl)-[1-[[1-(4-ethynylsulfonylphenyl)azetidin-3-yl]methyl]piperidin-4-yl]-(3-fluorophenyl)methyl]cyclopentyl]carbamate |
| SMILES | C#CS(=O)(=O)c1ccc(N2CC(CN3CCC(C(c4cccc(F)c4)([C@H]4CCC[C@@H]4NC(=O)OC)n4ccnc4CC)CC3)C2)cc1 |
| InChI | InChI=1S/C36H44FN5O4S/c1-4-34-38-18-21-42(34)36(28-8-6-9-29(37)22-28,32-10-7-11-33(32)39-35(43)46-3)27-16-19-40(20-17-27)23-26-24-41(25-26)30-12-14-31(15-13-30)47(44,45)5-2/h2,6,8-9,12-15,18,21-22,26-27,32-33H,4,7,10-11,16-17,19-20,23-25H2,1,3H3,(H,39,43)/t32-,33-,36?/m0/s1 |
| InChIKey | SEGOFMNWFTVQEA-JTXQMZLCSA-N |
| XLogP | 5.07 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.84 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|