C28H26N4O3S — CID 142446800
2-but-2-en-2-yl-N-isoquinolin-6-yl-3-[4-(pyridin-2-ylsulfamoyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 142446800) has the molecular formula C28H26N4O3S and a molecular weight of 498.61 g/mol. Its IUPAC name is 2-but-2-en-2-yl-N-isoquinolin-6-yl-3-[4-(pyridin-2-ylsulfamoyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | 2-but-2-en-2-yl-N-isoquinolin-6-yl-3-[4-(pyridin-2-ylsulfamoyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 142446800 |
| Molecular Formula | C28H26N4O3S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 2-but-2-en-2-yl-N-isoquinolin-6-yl-3-[4-(pyridin-2-ylsulfamoyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | CC=C(C)C1C(C(=O)Nc2ccc3cnccc3c2)C1c1ccc(S(=O)(=O)Nc2ccccn2)cc1 |
| InChI | InChI=1S/C28H26N4O3S/c1-3-18(2)25-26(27(25)28(33)31-22-10-7-21-17-29-15-13-20(21)16-22)19-8-11-23(12-9-19)36(34,35)32-24-6-4-5-14-30-24/h3-17,25-27H,1-2H3,(H,30,32)(H,31,33) |
| InChIKey | WRKHBCFSRXDJHO-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|