C25H29ClN4OS — CID 142446912
(2R)-N-(4-chloroisoquinolin-6-yl)-2-[4-(methylaminosulfanyl)phenyl]cyclopropane-1-carboxamide;piperidine (PubChem CID 142446912) has the molecular formula C25H29ClN4OS and a molecular weight of 469.05 g/mol. Its IUPAC name is (2R)-N-(4-chloroisoquinolin-6-yl)-2-[4-(methylaminosulfanyl)phenyl]cyclopropane-1-carboxamide;piperidine.
| Compound Name | (2R)-N-(4-chloroisoquinolin-6-yl)-2-[4-(methylaminosulfanyl)phenyl]cyclopropane-1-carboxamide;piperidine |
|---|---|
| PubChem CID | 142446912 |
| Molecular Formula | C25H29ClN4OS |
| Molecular Weight | 469.05 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | (2R)-N-(4-chloroisoquinolin-6-yl)-2-[4-(methylaminosulfanyl)phenyl]cyclopropane-1-carboxamide;piperidine |
| SMILES | C1CCNCC1.CNSc1ccc([C@@H]2CC2C(=O)Nc2ccc3cncc(Cl)c3c2)cc1 |
| InChI | InChI=1S/C20H18ClN3OS.C5H11N/c1-22-26-15-6-3-12(4-7-15)16-9-18(16)20(25)24-14-5-2-13-10-23-11-19(21)17(13)8-14;1-2-4-6-5-3-1/h2-8,10-11,16,18,22H,9H2,1H3,(H,24,25);6H,1-5H2/t16-,18?;/m0./s1 |
| InChIKey | MHLGGZFJMFYGMA-DMYPFFKMSA-N |
| XLogP | 5.62 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.05 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|