C11H16N2 — CID 142446949
(2E,4Z)-6-methyl-5-[(Z)-2-(methylideneamino)ethenyl]hepta-2,4,6-trien-3-amine (PubChem CID 142446949) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is (2E,4Z)-6-methyl-5-[(Z)-2-(methylideneamino)ethenyl]hepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z)-6-methyl-5-[(Z)-2-(methylideneamino)ethenyl]hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 142446949 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | (2E,4Z)-6-methyl-5-[(Z)-2-(methylideneamino)ethenyl]hepta-2,4,6-trien-3-amine |
| SMILES | C=N/C=C\C(=C\C(N)=C/C)C(=C)C |
| InChI | InChI=1S/C11H16N2/c1-5-11(12)8-10(9(2)3)6-7-13-4/h5-8H,2,4,12H2,1,3H3/b7-6-,10-8-,11-5+ |
| InChIKey | CHERUSZMDGLNRQ-WKHKJXMMSA-N |
| XLogP | 2.57 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|