C25H24FN9S — CID 142447867
7-fluoro-6-[4-methyl-5-(methylsulfanylamino)-3-pyridinyl]-3-N-(1,4,7,13-tetrazatricyclo[8.3.0.03,7]trideca-3,5,10,12-tetraen-12-yl)isoquinoline-3,8-diamine (PubChem CID 142447867) has the molecular formula C25H24FN9S and a molecular weight of 501.60 g/mol. Its IUPAC name is 7-fluoro-6-[4-methyl-5-(methylsulfanylamino)-3-pyridinyl]-3-N-(1,4,7,13-tetrazatricyclo[8.3.0.03,7]trideca-3,5,10,12-tetraen-12-yl)isoquinoline-3,8-diamine.
| Compound Name | 7-fluoro-6-[4-methyl-5-(methylsulfanylamino)-3-pyridinyl]-3-N-(1,4,7,13-tetrazatricyclo[8.3.0.03,7]trideca-3,5,10,12-tetraen-12-yl)isoquinoline-3,8-diamine |
|---|---|
| PubChem CID | 142447867 |
| Molecular Formula | C25H24FN9S |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 7-fluoro-6-[4-methyl-5-(methylsulfanylamino)-3-pyridinyl]-3-N-(1,4,7,13-tetrazatricyclo[8.3.0.03,7]trideca-3,5,10,12-tetraen-12-yl)isoquinoline-3,8-diamine |
| SMILES | CSNc1cncc(-c2cc3cc(Nc4cc5n(n4)Cc4nccn4CC5)ncc3c(N)c2F)c1C |
| InChI | InChI=1S/C25H24FN9S/c1-14-18(10-28-12-20(14)33-36-2)17-7-15-8-21(30-11-19(15)25(27)24(17)26)31-22-9-16-3-5-34-6-4-29-23(34)13-35(16)32-22/h4,6-12,33H,3,5,13,27H2,1-2H3,(H,30,31,32) |
| InChIKey | HTURZOQBTDRIDZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 111.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|