About 3,7-dihydrocyclohepta[d][1,3]oxazol-2-one;ethane;molecular hydrogen
3,7-dihydrocyclohepta[d][1,3]oxazol-2-one;ethane;molecular hydrogen (PubChem CID 142448158) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is 3,7-dihydrocyclohepta[d][1,3]oxazol-2-one;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | 3,7-dihydrocyclohepta[d][1,3]oxazol-2-one;ethane;molecular hydrogen |
| PubChem CID | 142448158 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 3,7-dihydrocyclohepta[d][1,3]oxazol-2-one;ethane;molecular hydrogen |
| SMILES | CC.O=c1[nH]c2c(o1)=CCC=CC=2.[H][H] |
| InChI | InChI=1S/C8H7NO2.C2H6.H2/c10-8-9-6-4-2-1-3-5-7(6)11-8;1-2;/h1-2,4-5H,3H2,(H,9,10);1-2H3;1H |
| InChIKey | BEPLWAOMJOPISQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,7-dihydrocyclohepta[d][1,3]oxazol-2-one;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dihydrocyclohepta[d][1,3]oxazol-2-one;ethane;molecular hydrogen?
The IUPAC name of 3,7-dihydrocyclohepta[d][1,3]oxazol-2-one;ethane;molecular hydrogen (CID 142448158) is 3,7-dihydrocyclohepta[d][1,3]oxazol-2-one;ethane;molecular hydrogen.
What is the SMILES notation for 3,7-dihydrocyclohepta[d][1,3]oxazol-2-one;ethane;molecular hydrogen?
The canonical SMILES for 3,7-dihydrocyclohepta[d][1,3]oxazol-2-one;ethane;molecular hydrogen is CC.O=c1[nH]c2c(o1)=CCC=CC=2.[H][H].
What is the InChIKey of 3,7-dihydrocyclohepta[d][1,3]oxazol-2-one;ethane;molecular hydrogen?
The InChIKey is BEPLWAOMJOPISQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2.C2H6.H2/c10-8-9-6-4-2-1-3-5-7(6)11-8;1-2;/h1-2,4-5H,3H2,(H,9,10);1-2H3;1H.
What are the key properties of 3,7-dihydrocyclohepta[d][1,3]oxazol-2-one;ethane;molecular hydrogen?
3,7-dihydrocyclohepta[d][1,3]oxazol-2-one;ethane;molecular hydrogen has a molecular weight of 181.23 g/mol, XLogP of 0.76, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dihydrocyclohepta[d][1,3]oxazol-2-one;ethane;molecular hydrogen is sourced from PubChem (CID 142448158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).