About ethane;propane;1,2,3-trimethyl-1H-indene
ethane;propane;1,2,3-trimethyl-1H-indene (PubChem CID 142448762) has the molecular formula C17H28
and a molecular weight of 232.41 g/mol. Its IUPAC name is ethane;propane;1,2,3-trimethyl-1H-indene.
Molecular Properties
| Compound Name | ethane;propane;1,2,3-trimethyl-1H-indene |
| PubChem CID | 142448762 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | ethane;propane;1,2,3-trimethyl-1H-indene |
| SMILES | CC.CC1=C(C)C(C)c2ccccc21.CCC |
| InChI | InChI=1S/C12H14.C3H8.C2H6/c1-8-9(2)11-6-4-5-7-12(11)10(8)3;1-3-2;1-2/h4-7,9H,1-3H3;3H2,1-2H3;1-2H3 |
| InChIKey | HSIQPLILIBKTRD-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;propane;1,2,3-trimethyl-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;propane;1,2,3-trimethyl-1H-indene?
The IUPAC name of ethane;propane;1,2,3-trimethyl-1H-indene (CID 142448762) is ethane;propane;1,2,3-trimethyl-1H-indene.
What is the SMILES notation for ethane;propane;1,2,3-trimethyl-1H-indene?
The canonical SMILES for ethane;propane;1,2,3-trimethyl-1H-indene is CC.CC1=C(C)C(C)c2ccccc21.CCC.
What is the InChIKey of ethane;propane;1,2,3-trimethyl-1H-indene?
The InChIKey is HSIQPLILIBKTRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14.C3H8.C2H6/c1-8-9(2)11-6-4-5-7-12(11)10(8)3;1-3-2;1-2/h4-7,9H,1-3H3;3H2,1-2H3;1-2H3.
What are the key properties of ethane;propane;1,2,3-trimethyl-1H-indene?
ethane;propane;1,2,3-trimethyl-1H-indene has a molecular weight of 232.41 g/mol, XLogP of 6.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propane;1,2,3-trimethyl-1H-indene is sourced from PubChem (CID 142448762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).