About 4-[4-[methyl(propyl)amino]anilino]-2-phenyl-6H-pyrimido[4,5-d]pyridazin-5-one
4-[4-[methyl(propyl)amino]anilino]-2-phenyl-6H-pyrimido[4,5-d]pyridazin-5-one (PubChem CID 142449544) has the molecular formula C22H22N6O
and a molecular weight of 386.46 g/mol. Its IUPAC name is 4-[4-[methyl(propyl)amino]anilino]-2-phenyl-6H-pyrimido[4,5-d]pyridazin-5-one.
Molecular Properties
| Compound Name | 4-[4-[methyl(propyl)amino]anilino]-2-phenyl-6H-pyrimido[4,5-d]pyridazin-5-one |
| PubChem CID | 142449544 |
| Molecular Formula | C22H22N6O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 4-[4-[methyl(propyl)amino]anilino]-2-phenyl-6H-pyrimido[4,5-d]pyridazin-5-one |
| SMILES | CCCN(C)c1ccc(Nc2nc(-c3ccccc3)nc3cn[nH]c(=O)c23)cc1 |
| InChI | InChI=1S/C22H22N6O/c1-3-13-28(2)17-11-9-16(10-12-17)24-21-19-18(14-23-27-22(19)29)25-20(26-21)15-7-5-4-6-8-15/h4-12,14H,3,13H2,1-2H3,(H,27,29)(H,24,25,26) |
| InChIKey | SDUIVMQRDQRZIF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[methyl(propyl)amino]anilino]-2-phenyl-6H-pyrimido[4,5-d]pyridazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[methyl(propyl)amino]anilino]-2-phenyl-6H-pyrimido[4,5-d]pyridazin-5-one?
The IUPAC name of 4-[4-[methyl(propyl)amino]anilino]-2-phenyl-6H-pyrimido[4,5-d]pyridazin-5-one (CID 142449544) is 4-[4-[methyl(propyl)amino]anilino]-2-phenyl-6H-pyrimido[4,5-d]pyridazin-5-one.
What is the SMILES notation for 4-[4-[methyl(propyl)amino]anilino]-2-phenyl-6H-pyrimido[4,5-d]pyridazin-5-one?
The canonical SMILES for 4-[4-[methyl(propyl)amino]anilino]-2-phenyl-6H-pyrimido[4,5-d]pyridazin-5-one is CCCN(C)c1ccc(Nc2nc(-c3ccccc3)nc3cn[nH]c(=O)c23)cc1.
What is the InChIKey of 4-[4-[methyl(propyl)amino]anilino]-2-phenyl-6H-pyrimido[4,5-d]pyridazin-5-one?
The InChIKey is SDUIVMQRDQRZIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N6O/c1-3-13-28(2)17-11-9-16(10-12-17)24-21-19-18(14-23-27-22(19)29)25-20(26-21)15-7-5-4-6-8-15/h4-12,14H,3,13H2,1-2H3,(H,27,29)(H,24,25,26).
What are the key properties of 4-[4-[methyl(propyl)amino]anilino]-2-phenyl-6H-pyrimido[4,5-d]pyridazin-5-one?
4-[4-[methyl(propyl)amino]anilino]-2-phenyl-6H-pyrimido[4,5-d]pyridazin-5-one has a molecular weight of 386.46 g/mol, XLogP of 3.97, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[methyl(propyl)amino]anilino]-2-phenyl-6H-pyrimido[4,5-d]pyridazin-5-one is sourced from PubChem (CID 142449544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).