C19H25N5O2 — CID 142449575
N'-[4-[3-(2-hydroxyethyl)piperidin-1-yl]phenyl]-4-methyl-6-oxo-1H-pyridazine-5-carboximidamide (PubChem CID 142449575) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is N'-[4-[3-(2-hydroxyethyl)piperidin-1-yl]phenyl]-4-methyl-6-oxo-1H-pyridazine-5-carboximidamide.
| Compound Name | N'-[4-[3-(2-hydroxyethyl)piperidin-1-yl]phenyl]-4-methyl-6-oxo-1H-pyridazine-5-carboximidamide |
|---|---|
| PubChem CID | 142449575 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | N'-[4-[3-(2-hydroxyethyl)piperidin-1-yl]phenyl]-4-methyl-6-oxo-1H-pyridazine-5-carboximidamide |
| SMILES | Cc1cn[nH]c(=O)c1/C(N)=N/c1ccc(N2CCCC(CCO)C2)cc1 |
| InChI | InChI=1S/C19H25N5O2/c1-13-11-21-23-19(26)17(13)18(20)22-15-4-6-16(7-5-15)24-9-2-3-14(12-24)8-10-25/h4-7,11,14,25H,2-3,8-10,12H2,1H3,(H2,20,22)(H,23,26) |
| InChIKey | AOPIIIPOSXQLSC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 107.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|