C23H28N8O — CID 142449586
2-[1-[4-[4-(diethylamino)anilino]-5-oxo-6H-pyrimido[4,5-d]pyridazin-2-yl]piperidin-4-yl]acetonitrile (PubChem CID 142449586) has the molecular formula C23H28N8O and a molecular weight of 432.53 g/mol. Its IUPAC name is 2-[1-[4-[4-(diethylamino)anilino]-5-oxo-6H-pyrimido[4,5-d]pyridazin-2-yl]piperidin-4-yl]acetonitrile.
| Compound Name | 2-[1-[4-[4-(diethylamino)anilino]-5-oxo-6H-pyrimido[4,5-d]pyridazin-2-yl]piperidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 142449586 |
| Molecular Formula | C23H28N8O |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 2-[1-[4-[4-(diethylamino)anilino]-5-oxo-6H-pyrimido[4,5-d]pyridazin-2-yl]piperidin-4-yl]acetonitrile |
| SMILES | CCN(CC)c1ccc(Nc2nc(N3CCC(CC#N)CC3)nc3cn[nH]c(=O)c23)cc1 |
| InChI | InChI=1S/C23H28N8O/c1-3-30(4-2)18-7-5-17(6-8-18)26-21-20-19(15-25-29-22(20)32)27-23(28-21)31-13-10-16(9-12-24)11-14-31/h5-8,15-16H,3-4,9-11,13-14H2,1-2H3,(H,29,32)(H,26,27,28) |
| InChIKey | BWWWITJBAYKRIK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|