C32H23F11N8O2 — CID 142449950
6-[6-(3,3-difluorocyclobutyl)oxy-3-pyridinyl]-1-(2,2,2-trifluoroethyl)benzotriazole;6-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-1-(2,2,2-trifluoroethyl)benzotriazole (PubChem CID 142449950) has the molecular formula C32H23F11N8O2 and a molecular weight of 760.57 g/mol. Its IUPAC name is 6-[6-(3,3-difluorocyclobutyl)oxy-3-pyridinyl]-1-(2,2,2-trifluoroethyl)benzotriazole;6-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-1-(2,2,2-trifluoroethyl)benzotriazole.
| Compound Name | 6-[6-(3,3-difluorocyclobutyl)oxy-3-pyridinyl]-1-(2,2,2-trifluoroethyl)benzotriazole;6-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-1-(2,2,2-trifluoroethyl)benzotriazole |
|---|---|
| PubChem CID | 142449950 |
| Molecular Formula | C32H23F11N8O2 |
| Molecular Weight | 760.57 g/mol |
| Exact Mass | 760.18 |
| IUPAC Name | 6-[6-(3,3-difluorocyclobutyl)oxy-3-pyridinyl]-1-(2,2,2-trifluoroethyl)benzotriazole;6-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-1-(2,2,2-trifluoroethyl)benzotriazole |
| SMILES | FC(F)(F)COc1ccc(-c2ccc3nnn(CC(F)(F)F)c3c2)cn1.FC(F)(F)Cn1nnc2ccc(-c3ccc(OC4CC(F)(F)C4)nc3)cc21 |
| InChI | InChI=1S/C17H13F5N4O.C15H10F6N4O/c18-16(19)6-12(7-16)27-15-4-2-11(8-23-15)10-1-3-13-14(5-10)26(25-24-13)9-17(20,21)22;16-14(17,18)7-25-12-5-9(1-3-11(12)23-24-25)10-2-4-13(22-6-10)26-8-15(19,20)21/h1-5,8,12H,6-7,9H2;1-6H,7-8H2 |
| InChIKey | LKNVNESHVHMLQC-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 105.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.57 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |