About 2-[amino(2,2,2-trifluoroethyl)amino]-6-bromopyridin-3-amine
2-[amino(2,2,2-trifluoroethyl)amino]-6-bromopyridin-3-amine (PubChem CID 142449959) has the molecular formula C7H8BrF3N4
and a molecular weight of 285.07 g/mol. Its IUPAC name is 2-[amino(2,2,2-trifluoroethyl)amino]-6-bromopyridin-3-amine.
Molecular Properties
| Compound Name | 2-[amino(2,2,2-trifluoroethyl)amino]-6-bromopyridin-3-amine |
| PubChem CID | 142449959 |
| Molecular Formula | C7H8BrF3N4 |
| Molecular Weight | 285.07 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | 2-[amino(2,2,2-trifluoroethyl)amino]-6-bromopyridin-3-amine |
| SMILES | Nc1ccc(Br)nc1N(N)CC(F)(F)F |
| InChI | InChI=1S/C7H8BrF3N4/c8-5-2-1-4(12)6(14-5)15(13)3-7(9,10)11/h1-2H,3,12-13H2 |
| InChIKey | JBPHZCDKCWODRQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.07 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[amino(2,2,2-trifluoroethyl)amino]-6-bromopyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[amino(2,2,2-trifluoroethyl)amino]-6-bromopyridin-3-amine?
The IUPAC name of 2-[amino(2,2,2-trifluoroethyl)amino]-6-bromopyridin-3-amine (CID 142449959) is 2-[amino(2,2,2-trifluoroethyl)amino]-6-bromopyridin-3-amine.
What is the SMILES notation for 2-[amino(2,2,2-trifluoroethyl)amino]-6-bromopyridin-3-amine?
The canonical SMILES for 2-[amino(2,2,2-trifluoroethyl)amino]-6-bromopyridin-3-amine is Nc1ccc(Br)nc1N(N)CC(F)(F)F.
What is the InChIKey of 2-[amino(2,2,2-trifluoroethyl)amino]-6-bromopyridin-3-amine?
The InChIKey is JBPHZCDKCWODRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrF3N4/c8-5-2-1-4(12)6(14-5)15(13)3-7(9,10)11/h1-2H,3,12-13H2.
What are the key properties of 2-[amino(2,2,2-trifluoroethyl)amino]-6-bromopyridin-3-amine?
2-[amino(2,2,2-trifluoroethyl)amino]-6-bromopyridin-3-amine has a molecular weight of 285.07 g/mol, XLogP of 1.67, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[amino(2,2,2-trifluoroethyl)amino]-6-bromopyridin-3-amine is sourced from PubChem (CID 142449959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).