C30H24F11N9O2 — CID 142449994
3-(2,2-difluoropropyl)-5-[4-(trifluoromethoxy)phenyl]triazolo[4,5-d]pyrimidine;ethane;1-(2,2,2-trifluoroethyl)-6-[4-(trifluoromethoxy)phenyl]triazolo[4,5-c]pyridine (PubChem CID 142449994) has the molecular formula C30H24F11N9O2 and a molecular weight of 751.56 g/mol. Its IUPAC name is 3-(2,2-difluoropropyl)-5-[4-(trifluoromethoxy)phenyl]triazolo[4,5-d]pyrimidine;ethane;1-(2,2,2-trifluoroethyl)-6-[4-(trifluoromethoxy)phenyl]triazolo[4,5-c]pyridine.
| Compound Name | 3-(2,2-difluoropropyl)-5-[4-(trifluoromethoxy)phenyl]triazolo[4,5-d]pyrimidine;ethane;1-(2,2,2-trifluoroethyl)-6-[4-(trifluoromethoxy)phenyl]triazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 142449994 |
| Molecular Formula | C30H24F11N9O2 |
| Molecular Weight | 751.56 g/mol |
| Exact Mass | 751.19 |
| IUPAC Name | 3-(2,2-difluoropropyl)-5-[4-(trifluoromethoxy)phenyl]triazolo[4,5-d]pyrimidine;ethane;1-(2,2,2-trifluoroethyl)-6-[4-(trifluoromethoxy)phenyl]triazolo[4,5-c]pyridine |
| SMILES | CC.CC(F)(F)Cn1nnc2cnc(-c3ccc(OC(F)(F)F)cc3)nc21.FC(F)(F)Cn1nnc2cnc(-c3ccc(OC(F)(F)F)cc3)cc21 |
| InChI | InChI=1S/C14H8F6N4O.C14H10F5N5O.C2H6/c15-13(16,17)7-24-12-5-10(21-6-11(12)22-23-24)8-1-3-9(4-2-8)25-14(18,19)20;1-13(15,16)7-24-12-10(22-23-24)6-20-11(21-12)8-2-4-9(5-3-8)25-14(17,18)19;1-2/h1-6H,7H2;2-6H,7H2,1H3;1-2H3 |
| InChIKey | RSSWYVZPKOXPCM-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 118.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.56 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |