C21H22N2O2S — CID 142450496
9-ethyl-9-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]spiro[5,7-dihydro-4H-[1,3]thiazolo[4,5-b]quinoline-6,3'-oxetane]-8-one (PubChem CID 142450496) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is 9-ethyl-9-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]spiro[5,7-dihydro-4H-[1,3]thiazolo[4,5-b]quinoline-6,3'-oxetane]-8-one.
| Compound Name | 9-ethyl-9-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]spiro[5,7-dihydro-4H-[1,3]thiazolo[4,5-b]quinoline-6,3'-oxetane]-8-one |
|---|---|
| PubChem CID | 142450496 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 9-ethyl-9-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]spiro[5,7-dihydro-4H-[1,3]thiazolo[4,5-b]quinoline-6,3'-oxetane]-8-one |
| SMILES | C#C/C=C\C(=C/C)C1(CC)C2=C(CC3(COC3)CC2=O)Nc2ncsc21 |
| InChI | InChI=1S/C21H22N2O2S/c1-4-7-8-14(5-2)21(6-3)17-15(23-19-18(21)26-13-22-19)9-20(10-16(17)24)11-25-12-20/h1,5,7-8,13,23H,6,9-12H2,2-3H3/b8-7-,14-5+ |
| InChIKey | SLLNECMBDXYEHP-KDDHRZGXSA-N |
| XLogP | 3.99 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|