C23H25F6NO4S2 — CID 142450847
[4-[[[5-(trifluoromethyl)furan-2-yl]methyl-(2,4,6-trimethylphenyl)sulfanylamino]methyl]cyclohexen-1-yl] trifluoromethanesulfonate (PubChem CID 142450847) has the molecular formula C23H25F6NO4S2 and a molecular weight of 557.58 g/mol. Its IUPAC name is [4-[[[5-(trifluoromethyl)furan-2-yl]methyl-(2,4,6-trimethylphenyl)sulfanylamino]methyl]cyclohexen-1-yl] trifluoromethanesulfonate.
| Compound Name | [4-[[[5-(trifluoromethyl)furan-2-yl]methyl-(2,4,6-trimethylphenyl)sulfanylamino]methyl]cyclohexen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 142450847 |
| Molecular Formula | C23H25F6NO4S2 |
| Molecular Weight | 557.58 g/mol |
| Exact Mass | 557.11 |
| IUPAC Name | [4-[[[5-(trifluoromethyl)furan-2-yl]methyl-(2,4,6-trimethylphenyl)sulfanylamino]methyl]cyclohexen-1-yl] trifluoromethanesulfonate |
| SMILES | Cc1cc(C)c(SN(Cc2ccc(C(F)(F)F)o2)CC2CC=C(OS(=O)(=O)C(F)(F)F)CC2)c(C)c1 |
| InChI | InChI=1S/C23H25F6NO4S2/c1-14-10-15(2)21(16(3)11-14)35-30(13-19-8-9-20(33-19)22(24,25)26)12-17-4-6-18(7-5-17)34-36(31,32)23(27,28)29/h6,8-11,17H,4-5,7,12-13H2,1-3H3 |
| InChIKey | RAWCAPDQWUDOCW-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.58 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|