C28H26F3NO2S2 — CID 142450850
1-[4-(3-hydroxysulfanylphenyl)phenyl]-N-[[5-(trifluoromethyl)furan-2-yl]methyl]-N-(2,4,6-trimethylphenyl)sulfanylmethanamine (PubChem CID 142450850) has the molecular formula C28H26F3NO2S2 and a molecular weight of 529.65 g/mol. Its IUPAC name is 1-[4-(3-hydroxysulfanylphenyl)phenyl]-N-[[5-(trifluoromethyl)furan-2-yl]methyl]-N-(2,4,6-trimethylphenyl)sulfanylmethanamine.
| Compound Name | 1-[4-(3-hydroxysulfanylphenyl)phenyl]-N-[[5-(trifluoromethyl)furan-2-yl]methyl]-N-(2,4,6-trimethylphenyl)sulfanylmethanamine |
|---|---|
| PubChem CID | 142450850 |
| Molecular Formula | C28H26F3NO2S2 |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 1-[4-(3-hydroxysulfanylphenyl)phenyl]-N-[[5-(trifluoromethyl)furan-2-yl]methyl]-N-(2,4,6-trimethylphenyl)sulfanylmethanamine |
| SMILES | Cc1cc(C)c(SN(Cc2ccc(-c3cccc(SO)c3)cc2)Cc2ccc(C(F)(F)F)o2)c(C)c1 |
| InChI | InChI=1S/C28H26F3NO2S2/c1-18-13-19(2)27(20(3)14-18)35-32(17-24-11-12-26(34-24)28(29,30)31)16-21-7-9-22(10-8-21)23-5-4-6-25(15-23)36-33/h4-15,33H,16-17H2,1-3H3 |
| InChIKey | DQXBRROBKNNZFI-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|