C30H29F2NO4S2 — CID 142450852
2-[3-[4-[[[5-(difluoromethyl)furan-2-yl]methyl-(2,4,6-trimethylphenyl)sulfanyloxyamino]methyl]phenyl]phenyl]sulfanylacetic acid (PubChem CID 142450852) has the molecular formula C30H29F2NO4S2 and a molecular weight of 569.70 g/mol. Its IUPAC name is 2-[3-[4-[[[5-(difluoromethyl)furan-2-yl]methyl-(2,4,6-trimethylphenyl)sulfanyloxyamino]methyl]phenyl]phenyl]sulfanylacetic acid.
| Compound Name | 2-[3-[4-[[[5-(difluoromethyl)furan-2-yl]methyl-(2,4,6-trimethylphenyl)sulfanyloxyamino]methyl]phenyl]phenyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 142450852 |
| Molecular Formula | C30H29F2NO4S2 |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.15 |
| IUPAC Name | 2-[3-[4-[[[5-(difluoromethyl)furan-2-yl]methyl-(2,4,6-trimethylphenyl)sulfanyloxyamino]methyl]phenyl]phenyl]sulfanylacetic acid |
| SMILES | Cc1cc(C)c(SON(Cc2ccc(-c3cccc(SCC(=O)O)c3)cc2)Cc2ccc(C(F)F)o2)c(C)c1 |
| InChI | InChI=1S/C30H29F2NO4S2/c1-19-13-20(2)29(21(3)14-19)39-37-33(17-25-11-12-27(36-25)30(31)32)16-22-7-9-23(10-8-22)24-5-4-6-26(15-24)38-18-28(34)35/h4-15,30H,16-18H2,1-3H3,(H,34,35) |
| InChIKey | JBCZMGIVEFFWBL-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|