C30H31F3N4OS — CID 142451053
N'-amino-2-[3-[4-[[[5-(trifluoromethyl)furan-2-yl]methyl-(2,4,6-trimethylphenyl)sulfanylamino]methyl]phenyl]phenyl]ethanimidamide (PubChem CID 142451053) has the molecular formula C30H31F3N4OS and a molecular weight of 552.67 g/mol. Its IUPAC name is N'-amino-2-[3-[4-[[[5-(trifluoromethyl)furan-2-yl]methyl-(2,4,6-trimethylphenyl)sulfanylamino]methyl]phenyl]phenyl]ethanimidamide.
| Compound Name | N'-amino-2-[3-[4-[[[5-(trifluoromethyl)furan-2-yl]methyl-(2,4,6-trimethylphenyl)sulfanylamino]methyl]phenyl]phenyl]ethanimidamide |
|---|---|
| PubChem CID | 142451053 |
| Molecular Formula | C30H31F3N4OS |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | N'-amino-2-[3-[4-[[[5-(trifluoromethyl)furan-2-yl]methyl-(2,4,6-trimethylphenyl)sulfanylamino]methyl]phenyl]phenyl]ethanimidamide |
| SMILES | Cc1cc(C)c(SN(Cc2ccc(-c3cccc(C/C(N)=N/N)c3)cc2)Cc2ccc(C(F)(F)F)o2)c(C)c1 |
| InChI | InChI=1S/C30H31F3N4OS/c1-19-13-20(2)29(21(3)14-19)39-37(18-26-11-12-27(38-26)30(31,32)33)17-22-7-9-24(10-8-22)25-6-4-5-23(15-25)16-28(34)36-35/h4-15H,16-18,35H2,1-3H3,(H2,34,36) |
| InChIKey | NFYQBILCWRJLIJ-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 80.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|