C28H22BrClF2N2O3 — CID 142451214
5-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-4-(2-chloro-3,6-difluorophenyl)pentanoic acid (PubChem CID 142451214) has the molecular formula C28H22BrClF2N2O3 and a molecular weight of 587.85 g/mol. Its IUPAC name is 5-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-4-(2-chloro-3,6-difluorophenyl)pentanoic acid.
| Compound Name | 5-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-4-(2-chloro-3,6-difluorophenyl)pentanoic acid |
|---|---|
| PubChem CID | 142451214 |
| Molecular Formula | C28H22BrClF2N2O3 |
| Molecular Weight | 587.85 g/mol |
| Exact Mass | 586.05 |
| IUPAC Name | 5-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-4-(2-chloro-3,6-difluorophenyl)pentanoic acid |
| SMILES | Cc1c(-c2ccccc2)nc2ccc(Br)cc2c1C(=O)NCC(CCC(=O)O)c1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C28H22BrClF2N2O3/c1-15-24(19-13-18(29)8-11-22(19)34-27(15)16-5-3-2-4-6-16)28(37)33-14-17(7-12-23(35)36)25-20(31)9-10-21(32)26(25)30/h2-6,8-11,13,17H,7,12,14H2,1H3,(H,33,37)(H,35,36) |
| InChIKey | YZDHMNSJTDELSQ-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.85 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|