About [4-ethoxy-3,3-difluoro-2-(2-methoxyphenyl)-4-oxobutyl]-methoxy-oxoazanium
[4-ethoxy-3,3-difluoro-2-(2-methoxyphenyl)-4-oxobutyl]-methoxy-oxoazanium (PubChem CID 142451266) has the molecular formula C14H18F2NO5+
and a molecular weight of 318.30 g/mol. Its IUPAC name is [4-ethoxy-3,3-difluoro-2-(2-methoxyphenyl)-4-oxobutyl]-methoxy-oxoazanium.
Molecular Properties
| Compound Name | [4-ethoxy-3,3-difluoro-2-(2-methoxyphenyl)-4-oxobutyl]-methoxy-oxoazanium |
| PubChem CID | 142451266 |
| Molecular Formula | C14H18F2NO5+ |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | [4-ethoxy-3,3-difluoro-2-(2-methoxyphenyl)-4-oxobutyl]-methoxy-oxoazanium |
| SMILES | CCOC(=O)C(F)(F)C(C[N+](=O)OC)c1ccccc1OC |
| InChI | InChI=1S/C14H18F2NO5/c1-4-22-13(18)14(15,16)11(9-17(19)21-3)10-7-5-6-8-12(10)20-2/h5-8,11H,4,9H2,1-3H3/q+1 |
| InChIKey | ASJYXJKXJULQBN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-ethoxy-3,3-difluoro-2-(2-methoxyphenyl)-4-oxobutyl]-methoxy-oxoazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-ethoxy-3,3-difluoro-2-(2-methoxyphenyl)-4-oxobutyl]-methoxy-oxoazanium?
The IUPAC name of [4-ethoxy-3,3-difluoro-2-(2-methoxyphenyl)-4-oxobutyl]-methoxy-oxoazanium (CID 142451266) is [4-ethoxy-3,3-difluoro-2-(2-methoxyphenyl)-4-oxobutyl]-methoxy-oxoazanium.
What is the SMILES notation for [4-ethoxy-3,3-difluoro-2-(2-methoxyphenyl)-4-oxobutyl]-methoxy-oxoazanium?
The canonical SMILES for [4-ethoxy-3,3-difluoro-2-(2-methoxyphenyl)-4-oxobutyl]-methoxy-oxoazanium is CCOC(=O)C(F)(F)C(C[N+](=O)OC)c1ccccc1OC.
What is the InChIKey of [4-ethoxy-3,3-difluoro-2-(2-methoxyphenyl)-4-oxobutyl]-methoxy-oxoazanium?
The InChIKey is ASJYXJKXJULQBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18F2NO5/c1-4-22-13(18)14(15,16)11(9-17(19)21-3)10-7-5-6-8-12(10)20-2/h5-8,11H,4,9H2,1-3H3/q+1.
What are the key properties of [4-ethoxy-3,3-difluoro-2-(2-methoxyphenyl)-4-oxobutyl]-methoxy-oxoazanium?
[4-ethoxy-3,3-difluoro-2-(2-methoxyphenyl)-4-oxobutyl]-methoxy-oxoazanium has a molecular weight of 318.30 g/mol, XLogP of 2.32, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-ethoxy-3,3-difluoro-2-(2-methoxyphenyl)-4-oxobutyl]-methoxy-oxoazanium is sourced from PubChem (CID 142451266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).