About (1Z)-N-methyl-1-(methylideneamino)-N-propan-2-ylbuta-1,3-dien-1-amine
(1Z)-N-methyl-1-(methylideneamino)-N-propan-2-ylbuta-1,3-dien-1-amine (PubChem CID 142451889) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is (1Z)-N-methyl-1-(methylideneamino)-N-propan-2-ylbuta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | (1Z)-N-methyl-1-(methylideneamino)-N-propan-2-ylbuta-1,3-dien-1-amine |
| PubChem CID | 142451889 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (1Z)-N-methyl-1-(methylideneamino)-N-propan-2-ylbuta-1,3-dien-1-amine |
| SMILES | C=C/C=C(\N=C)N(C)C(C)C |
| InChI | InChI=1S/C9H16N2/c1-6-7-9(10-4)11(5)8(2)3/h6-8H,1,4H2,2-3,5H3/b9-7+ |
| InChIKey | BEJKOUMAHSCTLK-VQHVLOKHSA-N |
| XLogP | 2.05 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-N-methyl-1-(methylideneamino)-N-propan-2-ylbuta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-N-methyl-1-(methylideneamino)-N-propan-2-ylbuta-1,3-dien-1-amine?
The IUPAC name of (1Z)-N-methyl-1-(methylideneamino)-N-propan-2-ylbuta-1,3-dien-1-amine (CID 142451889) is (1Z)-N-methyl-1-(methylideneamino)-N-propan-2-ylbuta-1,3-dien-1-amine.
What is the SMILES notation for (1Z)-N-methyl-1-(methylideneamino)-N-propan-2-ylbuta-1,3-dien-1-amine?
The canonical SMILES for (1Z)-N-methyl-1-(methylideneamino)-N-propan-2-ylbuta-1,3-dien-1-amine is C=C/C=C(\N=C)N(C)C(C)C.
What is the InChIKey of (1Z)-N-methyl-1-(methylideneamino)-N-propan-2-ylbuta-1,3-dien-1-amine?
The InChIKey is BEJKOUMAHSCTLK-VQHVLOKHSA-N. The full InChI is InChI=1S/C9H16N2/c1-6-7-9(10-4)11(5)8(2)3/h6-8H,1,4H2,2-3,5H3/b9-7+.
What are the key properties of (1Z)-N-methyl-1-(methylideneamino)-N-propan-2-ylbuta-1,3-dien-1-amine?
(1Z)-N-methyl-1-(methylideneamino)-N-propan-2-ylbuta-1,3-dien-1-amine has a molecular weight of 152.24 g/mol, XLogP of 2.05, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-N-methyl-1-(methylideneamino)-N-propan-2-ylbuta-1,3-dien-1-amine is sourced from PubChem (CID 142451889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).