About 4-hydroxypentanamide;3-methylbutan-1-ol
4-hydroxypentanamide;3-methylbutan-1-ol (PubChem CID 142452022) has the molecular formula C10H23NO3
and a molecular weight of 205.30 g/mol. Its IUPAC name is 4-hydroxypentanamide;3-methylbutan-1-ol.
Molecular Properties
| Compound Name | 4-hydroxypentanamide;3-methylbutan-1-ol |
| PubChem CID | 142452022 |
| Molecular Formula | C10H23NO3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.17 |
| IUPAC Name | 4-hydroxypentanamide;3-methylbutan-1-ol |
| SMILES | CC(C)CCO.CC(O)CCC(N)=O |
| InChI | InChI=1S/C5H11NO2.C5H12O/c1-4(7)2-3-5(6)8;1-5(2)3-4-6/h4,7H,2-3H2,1H3,(H2,6,8);5-6H,3-4H2,1-2H3 |
| InChIKey | ZJLJQVNKMBLSDG-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-hydroxypentanamide;3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxypentanamide;3-methylbutan-1-ol?
The IUPAC name of 4-hydroxypentanamide;3-methylbutan-1-ol (CID 142452022) is 4-hydroxypentanamide;3-methylbutan-1-ol.
What is the SMILES notation for 4-hydroxypentanamide;3-methylbutan-1-ol?
The canonical SMILES for 4-hydroxypentanamide;3-methylbutan-1-ol is CC(C)CCO.CC(O)CCC(N)=O.
What is the InChIKey of 4-hydroxypentanamide;3-methylbutan-1-ol?
The InChIKey is ZJLJQVNKMBLSDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.C5H12O/c1-4(7)2-3-5(6)8;1-5(2)3-4-6/h4,7H,2-3H2,1H3,(H2,6,8);5-6H,3-4H2,1-2H3.
What are the key properties of 4-hydroxypentanamide;3-methylbutan-1-ol?
4-hydroxypentanamide;3-methylbutan-1-ol has a molecular weight of 205.30 g/mol, XLogP of 0.66, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxypentanamide;3-methylbutan-1-ol is sourced from PubChem (CID 142452022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).