C13H19NO2S — CID 142452708
ethane;5-methylsulfanylisoindole-1,3-dione (PubChem CID 142452708) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is ethane;5-methylsulfanylisoindole-1,3-dione.
| Compound Name | ethane;5-methylsulfanylisoindole-1,3-dione |
|---|---|
| PubChem CID | 142452708 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | ethane;5-methylsulfanylisoindole-1,3-dione |
| SMILES | CC.CC.CSc1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C9H7NO2S.2C2H6/c1-13-5-2-3-6-7(4-5)9(12)10-8(6)11;2*1-2/h2-4H,1H3,(H,10,11,12);2*1-2H3 |
| InChIKey | QFZZKDJNWPQGOD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|