About ethane;5-methylsulfanylisoindole-1,3-dione
ethane;5-methylsulfanylisoindole-1,3-dione (PubChem CID 142452708) has the molecular formula C13H19NO2S
and a molecular weight of 253.37 g/mol. Its IUPAC name is ethane;5-methylsulfanylisoindole-1,3-dione.
Molecular Properties
| Compound Name | ethane;5-methylsulfanylisoindole-1,3-dione |
| PubChem CID | 142452708 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | ethane;5-methylsulfanylisoindole-1,3-dione |
| SMILES | CC.CC.CSc1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C9H7NO2S.2C2H6/c1-13-5-2-3-6-7(4-5)9(12)10-8(6)11;2*1-2/h2-4H,1H3,(H,10,11,12);2*1-2H3 |
| InChIKey | QFZZKDJNWPQGOD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-methylsulfanylisoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methylsulfanylisoindole-1,3-dione?
The IUPAC name of ethane;5-methylsulfanylisoindole-1,3-dione (CID 142452708) is ethane;5-methylsulfanylisoindole-1,3-dione.
What is the SMILES notation for ethane;5-methylsulfanylisoindole-1,3-dione?
The canonical SMILES for ethane;5-methylsulfanylisoindole-1,3-dione is CC.CC.CSc1ccc2c(c1)C(=O)NC2=O.
What is the InChIKey of ethane;5-methylsulfanylisoindole-1,3-dione?
The InChIKey is QFZZKDJNWPQGOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2S.2C2H6/c1-13-5-2-3-6-7(4-5)9(12)10-8(6)11;2*1-2/h2-4H,1H3,(H,10,11,12);2*1-2H3.
What are the key properties of ethane;5-methylsulfanylisoindole-1,3-dione?
ethane;5-methylsulfanylisoindole-1,3-dione has a molecular weight of 253.37 g/mol, XLogP of 3.34, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methylsulfanylisoindole-1,3-dione is sourced from PubChem (CID 142452708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).