About 4-[5-chloro-3-(2-chlorophenyl)-1-ethyl-6-oxo-2-pyridinyl]-3,5-difluorobenzonitrile
4-[5-chloro-3-(2-chlorophenyl)-1-ethyl-6-oxo-2-pyridinyl]-3,5-difluorobenzonitrile (PubChem CID 142452779) has the molecular formula C20H12Cl2F2N2O
and a molecular weight of 405.23 g/mol. Its IUPAC name is 4-[5-chloro-3-(2-chlorophenyl)-1-ethyl-6-oxo-2-pyridinyl]-3,5-difluorobenzonitrile.
Molecular Properties
| Compound Name | 4-[5-chloro-3-(2-chlorophenyl)-1-ethyl-6-oxo-2-pyridinyl]-3,5-difluorobenzonitrile |
| PubChem CID | 142452779 |
| Molecular Formula | C20H12Cl2F2N2O |
| Molecular Weight | 405.23 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 4-[5-chloro-3-(2-chlorophenyl)-1-ethyl-6-oxo-2-pyridinyl]-3,5-difluorobenzonitrile |
| SMILES | CCn1c(-c2c(F)cc(C#N)cc2F)c(-c2ccccc2Cl)cc(Cl)c1=O |
| InChI | InChI=1S/C20H12Cl2F2N2O/c1-2-26-19(18-16(23)7-11(10-25)8-17(18)24)13(9-15(22)20(26)27)12-5-3-4-6-14(12)21/h3-9H,2H2,1H3 |
| InChIKey | UPFKQWOBVOGNQW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.23 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[5-chloro-3-(2-chlorophenyl)-1-ethyl-6-oxo-2-pyridinyl]-3,5-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-chloro-3-(2-chlorophenyl)-1-ethyl-6-oxo-2-pyridinyl]-3,5-difluorobenzonitrile?
The IUPAC name of 4-[5-chloro-3-(2-chlorophenyl)-1-ethyl-6-oxo-2-pyridinyl]-3,5-difluorobenzonitrile (CID 142452779) is 4-[5-chloro-3-(2-chlorophenyl)-1-ethyl-6-oxo-2-pyridinyl]-3,5-difluorobenzonitrile.
What is the SMILES notation for 4-[5-chloro-3-(2-chlorophenyl)-1-ethyl-6-oxo-2-pyridinyl]-3,5-difluorobenzonitrile?
The canonical SMILES for 4-[5-chloro-3-(2-chlorophenyl)-1-ethyl-6-oxo-2-pyridinyl]-3,5-difluorobenzonitrile is CCn1c(-c2c(F)cc(C#N)cc2F)c(-c2ccccc2Cl)cc(Cl)c1=O.
What is the InChIKey of 4-[5-chloro-3-(2-chlorophenyl)-1-ethyl-6-oxo-2-pyridinyl]-3,5-difluorobenzonitrile?
The InChIKey is UPFKQWOBVOGNQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12Cl2F2N2O/c1-2-26-19(18-16(23)7-11(10-25)8-17(18)24)13(9-15(22)20(26)27)12-5-3-4-6-14(12)21/h3-9H,2H2,1H3.
What are the key properties of 4-[5-chloro-3-(2-chlorophenyl)-1-ethyl-6-oxo-2-pyridinyl]-3,5-difluorobenzonitrile?
4-[5-chloro-3-(2-chlorophenyl)-1-ethyl-6-oxo-2-pyridinyl]-3,5-difluorobenzonitrile has a molecular weight of 405.23 g/mol, XLogP of 5.66, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-chloro-3-(2-chlorophenyl)-1-ethyl-6-oxo-2-pyridinyl]-3,5-difluorobenzonitrile is sourced from PubChem (CID 142452779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).