C23H22ClF2NO3 — CID 142452805
5-(2-chlorophenyl)-6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1-ethyl-3-methylpyridin-2-one (PubChem CID 142452805) has the molecular formula C23H22ClF2NO3 and a molecular weight of 433.88 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1-ethyl-3-methylpyridin-2-one.
| Compound Name | 5-(2-chlorophenyl)-6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1-ethyl-3-methylpyridin-2-one |
|---|---|
| PubChem CID | 142452805 |
| Molecular Formula | C23H22ClF2NO3 |
| Molecular Weight | 433.88 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 5-(2-chlorophenyl)-6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1-ethyl-3-methylpyridin-2-one |
| SMILES | CCn1c(-c2c(F)cc(OCCOC)cc2F)c(-c2ccccc2Cl)cc(C)c1=O |
| InChI | InChI=1S/C23H22ClF2NO3/c1-4-27-22(21-19(25)12-15(13-20(21)26)30-10-9-29-3)17(11-14(2)23(27)28)16-7-5-6-8-18(16)24/h5-8,11-13H,4,9-10H2,1-3H3 |
| InChIKey | HMLCFNYXCDJZPE-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.88 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|