About cyclohexanol;5,6-dichloro-4-methoxy-2-pyridin-4-yl-1H-benzimidazole
cyclohexanol;5,6-dichloro-4-methoxy-2-pyridin-4-yl-1H-benzimidazole (PubChem CID 142454153) has the molecular formula C19H21Cl2N3O2
and a molecular weight of 394.30 g/mol. Its IUPAC name is cyclohexanol;5,6-dichloro-4-methoxy-2-pyridin-4-yl-1H-benzimidazole.
Molecular Properties
| Compound Name | cyclohexanol;5,6-dichloro-4-methoxy-2-pyridin-4-yl-1H-benzimidazole |
| PubChem CID | 142454153 |
| Molecular Formula | C19H21Cl2N3O2 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | cyclohexanol;5,6-dichloro-4-methoxy-2-pyridin-4-yl-1H-benzimidazole |
| SMILES | COc1c(Cl)c(Cl)cc2[nH]c(-c3ccncc3)nc12.OC1CCCCC1 |
| InChI | InChI=1S/C13H9Cl2N3O.C6H12O/c1-19-12-10(15)8(14)6-9-11(12)18-13(17-9)7-2-4-16-5-3-7;7-6-4-2-1-3-5-6/h2-6H,1H3,(H,17,18);6-7H,1-5H2 |
| InChIKey | OVLJHYPHBVMGEB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclohexanol;5,6-dichloro-4-methoxy-2-pyridin-4-yl-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanol;5,6-dichloro-4-methoxy-2-pyridin-4-yl-1H-benzimidazole?
The IUPAC name of cyclohexanol;5,6-dichloro-4-methoxy-2-pyridin-4-yl-1H-benzimidazole (CID 142454153) is cyclohexanol;5,6-dichloro-4-methoxy-2-pyridin-4-yl-1H-benzimidazole.
What is the SMILES notation for cyclohexanol;5,6-dichloro-4-methoxy-2-pyridin-4-yl-1H-benzimidazole?
The canonical SMILES for cyclohexanol;5,6-dichloro-4-methoxy-2-pyridin-4-yl-1H-benzimidazole is COc1c(Cl)c(Cl)cc2[nH]c(-c3ccncc3)nc12.OC1CCCCC1.
What is the InChIKey of cyclohexanol;5,6-dichloro-4-methoxy-2-pyridin-4-yl-1H-benzimidazole?
The InChIKey is OVLJHYPHBVMGEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl2N3O.C6H12O/c1-19-12-10(15)8(14)6-9-11(12)18-13(17-9)7-2-4-16-5-3-7;7-6-4-2-1-3-5-6/h2-6H,1H3,(H,17,18);6-7H,1-5H2.
What are the key properties of cyclohexanol;5,6-dichloro-4-methoxy-2-pyridin-4-yl-1H-benzimidazole?
cyclohexanol;5,6-dichloro-4-methoxy-2-pyridin-4-yl-1H-benzimidazole has a molecular weight of 394.30 g/mol, XLogP of 5.25, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanol;5,6-dichloro-4-methoxy-2-pyridin-4-yl-1H-benzimidazole is sourced from PubChem (CID 142454153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).