C27H22F4N6O3S — CID 142455422
[(4aS,6S)-1-(4-fluorophenyl)-6-[(1-methyl-1,2,4-triazol-3-yl)sulfonyl]-5,6,7,8-tetrahydro-4H-benzo[f]indazol-4a-yl]-[5-(trifluoromethyl)-2-pyridinyl]methanone (PubChem CID 142455422) has the molecular formula C27H22F4N6O3S and a molecular weight of 586.57 g/mol. Its IUPAC name is [(4aS,6S)-1-(4-fluorophenyl)-6-[(1-methyl-1,2,4-triazol-3-yl)sulfonyl]-5,6,7,8-tetrahydro-4H-benzo[f]indazol-4a-yl]-[5-(trifluoromethyl)-2-pyridinyl]methanone.
| Compound Name | [(4aS,6S)-1-(4-fluorophenyl)-6-[(1-methyl-1,2,4-triazol-3-yl)sulfonyl]-5,6,7,8-tetrahydro-4H-benzo[f]indazol-4a-yl]-[5-(trifluoromethyl)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 142455422 |
| Molecular Formula | C27H22F4N6O3S |
| Molecular Weight | 586.57 g/mol |
| Exact Mass | 586.14 |
| IUPAC Name | [(4aS,6S)-1-(4-fluorophenyl)-6-[(1-methyl-1,2,4-triazol-3-yl)sulfonyl]-5,6,7,8-tetrahydro-4H-benzo[f]indazol-4a-yl]-[5-(trifluoromethyl)-2-pyridinyl]methanone |
| SMILES | Cn1cnc(S(=O)(=O)[C@H]2CCC3=Cc4c(cnn4-c4ccc(F)cc4)C[C@]3(C(=O)c3ccc(C(F)(F)F)cn3)C2)n1 |
| InChI | InChI=1S/C27H22F4N6O3S/c1-36-15-33-25(35-36)41(39,40)21-8-2-17-10-23-16(13-34-37(23)20-6-4-19(28)5-7-20)11-26(17,12-21)24(38)22-9-3-18(14-32-22)27(29,30)31/h3-7,9-10,13-15,21H,2,8,11-12H2,1H3/t21-,26-/m0/s1 |
| InChIKey | YLQRWEXXECMSPJ-LVXARBLLSA-N |
| XLogP | 4.39 |
| TPSA | 112.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |