C30H26F3N3O3S — CID 142455486
[(4aS,6S)-6-[(3,4-difluorophenyl)-dihydroxy-λ4-sulfanyl]-1-(4-fluorophenyl)-5,6,7,8-tetrahydro-4H-benzo[f]indazol-4a-yl]-(4-methyl-2-pyridinyl)methanone (PubChem CID 142455486) has the molecular formula C30H26F3N3O3S and a molecular weight of 565.62 g/mol. Its IUPAC name is [(4aS,6S)-6-[(3,4-difluorophenyl)-dihydroxy-λ4-sulfanyl]-1-(4-fluorophenyl)-5,6,7,8-tetrahydro-4H-benzo[f]indazol-4a-yl]-(4-methyl-2-pyridinyl)methanone.
| Compound Name | [(4aS,6S)-6-[(3,4-difluorophenyl)-dihydroxy-λ4-sulfanyl]-1-(4-fluorophenyl)-5,6,7,8-tetrahydro-4H-benzo[f]indazol-4a-yl]-(4-methyl-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 142455486 |
| Molecular Formula | C30H26F3N3O3S |
| Molecular Weight | 565.62 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | [(4aS,6S)-6-[(3,4-difluorophenyl)-dihydroxy-λ4-sulfanyl]-1-(4-fluorophenyl)-5,6,7,8-tetrahydro-4H-benzo[f]indazol-4a-yl]-(4-methyl-2-pyridinyl)methanone |
| SMILES | Cc1ccnc(C(=O)[C@]23Cc4cnn(-c5ccc(F)cc5)c4C=C2CC[C@H](S(O)(O)c2ccc(F)c(F)c2)C3)c1 |
| InChI | InChI=1S/C30H26F3N3O3S/c1-18-10-11-34-27(12-18)29(37)30-15-19-17-35-36(22-5-3-21(31)4-6-22)28(19)13-20(30)2-7-24(16-30)40(38,39)23-8-9-25(32)26(33)14-23/h3-6,8-14,17,24,38-39H,2,7,15-16H2,1H3/t24-,30-/m0/s1 |
| InChIKey | PJHWPALVBAZDML-NGQVCNFZSA-N |
| XLogP | 7.16 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.62 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |