C28H26F4N6O3S2 — CID 142455747
N-[(4aS,6S)-1-(4-fluorophenyl)-4a-[5-(trifluoromethyl)-1,3-thiazole-2-carbonyl]-5,6,7,8-tetrahydro-4H-benzo[f]indazol-6-yl]-N-ethyl-1-methylimidazole-4-sulfonamide (PubChem CID 142455747) has the molecular formula C28H26F4N6O3S2 and a molecular weight of 634.68 g/mol. Its IUPAC name is N-[(4aS,6S)-1-(4-fluorophenyl)-4a-[5-(trifluoromethyl)-1,3-thiazole-2-carbonyl]-5,6,7,8-tetrahydro-4H-benzo[f]indazol-6-yl]-N-ethyl-1-methylimidazole-4-sulfonamide.
| Compound Name | N-[(4aS,6S)-1-(4-fluorophenyl)-4a-[5-(trifluoromethyl)-1,3-thiazole-2-carbonyl]-5,6,7,8-tetrahydro-4H-benzo[f]indazol-6-yl]-N-ethyl-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 142455747 |
| Molecular Formula | C28H26F4N6O3S2 |
| Molecular Weight | 634.68 g/mol |
| Exact Mass | 634.14 |
| IUPAC Name | N-[(4aS,6S)-1-(4-fluorophenyl)-4a-[5-(trifluoromethyl)-1,3-thiazole-2-carbonyl]-5,6,7,8-tetrahydro-4H-benzo[f]indazol-6-yl]-N-ethyl-1-methylimidazole-4-sulfonamide |
| SMILES | CCN([C@H]1CCC2=Cc3c(cnn3-c3ccc(F)cc3)C[C@]2(C(=O)c2ncc(C(F)(F)F)s2)C1)S(=O)(=O)c1cn(C)cn1 |
| InChI | InChI=1S/C28H26F4N6O3S2/c1-3-37(43(40,41)24-15-36(2)16-34-24)21-7-4-18-10-22-17(13-35-38(22)20-8-5-19(29)6-9-20)11-27(18,12-21)25(39)26-33-14-23(42-26)28(30,31)32/h5-6,8-10,13-16,21H,3-4,7,11-12H2,1-2H3/t21-,27-/m0/s1 |
| InChIKey | GFAODZJTUFRATN-IDISGSTGSA-N |
| XLogP | 5.29 |
| TPSA | 102.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.68 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |