C28H23F3N6O4 — CID 142456360
3-[10-(4,4-difluoro-3-hydroxypiperidine-1-carbonyl)-6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]-4-imidazo[1,2-a]pyridin-3-ylpyrrole-2,5-dione (PubChem CID 142456360) has the molecular formula C28H23F3N6O4 and a molecular weight of 564.52 g/mol. Its IUPAC name is 3-[10-(4,4-difluoro-3-hydroxypiperidine-1-carbonyl)-6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]-4-imidazo[1,2-a]pyridin-3-ylpyrrole-2,5-dione.
| Compound Name | 3-[10-(4,4-difluoro-3-hydroxypiperidine-1-carbonyl)-6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]-4-imidazo[1,2-a]pyridin-3-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 142456360 |
| Molecular Formula | C28H23F3N6O4 |
| Molecular Weight | 564.52 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | 3-[10-(4,4-difluoro-3-hydroxypiperidine-1-carbonyl)-6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]-4-imidazo[1,2-a]pyridin-3-ylpyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cnc3ccccn23)=C1c1cn2c3c(cc(F)cc13)CN(C(=O)N1CCC(F)(F)C(O)C1)CC2 |
| InChI | InChI=1S/C28H23F3N6O4/c29-16-9-15-12-36(27(41)35-6-4-28(30,31)20(38)14-35)8-7-34-13-18(17(10-16)24(15)34)22-23(26(40)33-25(22)39)19-11-32-21-3-1-2-5-37(19)21/h1-3,5,9-11,13,20,38H,4,6-8,12,14H2,(H,33,39,40) |
| InChIKey | NFFQIPOEHXWNOR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|