C32H32F3N5O4 — CID 142456405
(Z)-3-[10-[4-(hydroxymethyl)piperidine-1-carbonyl]-6-(trifluoromethyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]-4-imidazo[1,2-a]pyridin-3-ylhex-3-ene-2,5-dione (PubChem CID 142456405) has the molecular formula C32H32F3N5O4 and a molecular weight of 607.63 g/mol. Its IUPAC name is (Z)-3-[10-[4-(hydroxymethyl)piperidine-1-carbonyl]-6-(trifluoromethyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]-4-imidazo[1,2-a]pyridin-3-ylhex-3-ene-2,5-dione.
| Compound Name | (Z)-3-[10-[4-(hydroxymethyl)piperidine-1-carbonyl]-6-(trifluoromethyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]-4-imidazo[1,2-a]pyridin-3-ylhex-3-ene-2,5-dione |
|---|---|
| PubChem CID | 142456405 |
| Molecular Formula | C32H32F3N5O4 |
| Molecular Weight | 607.63 g/mol |
| Exact Mass | 607.24 |
| IUPAC Name | (Z)-3-[10-[4-(hydroxymethyl)piperidine-1-carbonyl]-6-(trifluoromethyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]-4-imidazo[1,2-a]pyridin-3-ylhex-3-ene-2,5-dione |
| SMILES | CC(=O)/C(=C(\C(C)=O)c1cnc2ccccn12)c1cn2c3c(cc(C(F)(F)F)cc13)CN(C(=O)N1CCC(CO)CC1)CC2 |
| InChI | InChI=1S/C32H32F3N5O4/c1-19(42)28(29(20(2)43)26-15-36-27-5-3-4-8-40(26)27)25-17-38-11-12-39(31(44)37-9-6-21(18-41)7-10-37)16-22-13-23(32(33,34)35)14-24(25)30(22)38/h3-5,8,13-15,17,21,41H,6-7,9-12,16,18H2,1-2H3/b29-28- |
| InChIKey | RBPLCFLIBZTWBJ-ZIADKAODSA-N |
| XLogP | 5.04 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.63 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|