C22H15FN4O3 — CID 142456419
3-(1,2-benzoxazol-3-yl)-4-(6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl)pyrrole-2,5-dione (PubChem CID 142456419) has the molecular formula C22H15FN4O3 and a molecular weight of 402.39 g/mol. Its IUPAC name is 3-(1,2-benzoxazol-3-yl)-4-(6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-(1,2-benzoxazol-3-yl)-4-(6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 142456419 |
| Molecular Formula | C22H15FN4O3 |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 3-(1,2-benzoxazol-3-yl)-4-(6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn3c4c(cc(F)cc24)CNCC3)=C1c1noc2ccccc12 |
| InChI | InChI=1S/C22H15FN4O3/c23-12-7-11-9-24-5-6-27-10-15(14(8-12)20(11)27)17-18(22(29)25-21(17)28)19-13-3-1-2-4-16(13)30-26-19/h1-4,7-8,10,24H,5-6,9H2,(H,25,28,29) |
| InChIKey | OQRMVOCZPUWQGP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|