C25H40N2O4S — CID 142456575
(10R)-11-hydroxy-8,8,10-trimethyl-3-[(E)-1-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)prop-1-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 142456575) has the molecular formula C25H40N2O4S and a molecular weight of 464.67 g/mol. Its IUPAC name is (10R)-11-hydroxy-8,8,10-trimethyl-3-[(E)-1-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)prop-1-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (10R)-11-hydroxy-8,8,10-trimethyl-3-[(E)-1-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)prop-1-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 142456575 |
| Molecular Formula | C25H40N2O4S |
| Molecular Weight | 464.67 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | (10R)-11-hydroxy-8,8,10-trimethyl-3-[(E)-1-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)prop-1-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C/C(=C\C1=CSC(C)N1)C1CC2OC2CCCCC(O)[C@@H](C)C(=O)C(C)(C)CCC(=O)N1 |
| InChI | InChI=1S/C25H40N2O4S/c1-15(12-18-14-32-17(3)26-18)19-13-22-21(31-22)9-7-6-8-20(28)16(2)24(30)25(4,5)11-10-23(29)27-19/h12,14,16-17,19-22,26,28H,6-11,13H2,1-5H3,(H,27,29)/b15-12+/t16-,17?,19?,20?,21?,22?/m1/s1 |
| InChIKey | XMZPXYCZGSISRY-NYFLGQAISA-N |
| XLogP | 4.05 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.67 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|