About 1-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]-3-fluoro-1-methoxypropan-2-amine
1-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]-3-fluoro-1-methoxypropan-2-amine (PubChem CID 142457056) has the molecular formula C11H16FN5O
and a molecular weight of 253.28 g/mol. Its IUPAC name is 1-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]-3-fluoro-1-methoxypropan-2-amine.
Molecular Properties
| Compound Name | 1-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]-3-fluoro-1-methoxypropan-2-amine |
| PubChem CID | 142457056 |
| Molecular Formula | C11H16FN5O |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 1-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]-3-fluoro-1-methoxypropan-2-amine |
| SMILES | COC(c1ccc(C2=NNNN2)cc1)C(N)CF |
| InChI | InChI=1S/C11H16FN5O/c1-18-10(9(13)6-12)7-2-4-8(5-3-7)11-14-16-17-15-11/h2-5,9-10,16-17H,6,13H2,1H3,(H,14,15) |
| InChIKey | NSHYBCXLGJYPDG-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]-3-fluoro-1-methoxypropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]-3-fluoro-1-methoxypropan-2-amine?
The IUPAC name of 1-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]-3-fluoro-1-methoxypropan-2-amine (CID 142457056) is 1-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]-3-fluoro-1-methoxypropan-2-amine.
What is the SMILES notation for 1-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]-3-fluoro-1-methoxypropan-2-amine?
The canonical SMILES for 1-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]-3-fluoro-1-methoxypropan-2-amine is COC(c1ccc(C2=NNNN2)cc1)C(N)CF.
What is the InChIKey of 1-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]-3-fluoro-1-methoxypropan-2-amine?
The InChIKey is NSHYBCXLGJYPDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16FN5O/c1-18-10(9(13)6-12)7-2-4-8(5-3-7)11-14-16-17-15-11/h2-5,9-10,16-17H,6,13H2,1H3,(H,14,15).
What are the key properties of 1-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]-3-fluoro-1-methoxypropan-2-amine?
1-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]-3-fluoro-1-methoxypropan-2-amine has a molecular weight of 253.28 g/mol, XLogP of -0.06, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]-3-fluoro-1-methoxypropan-2-amine is sourced from PubChem (CID 142457056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).