C19H29FN2O2 — CID 142457099
(2Z,4E)-5-[4-(2-amino-3-fluoro-1-methoxypropyl)phenyl]-N-methoxyocta-2,4-dien-2-amine (PubChem CID 142457099) has the molecular formula C19H29FN2O2 and a molecular weight of 336.45 g/mol. Its IUPAC name is (2Z,4E)-5-[4-(2-amino-3-fluoro-1-methoxypropyl)phenyl]-N-methoxyocta-2,4-dien-2-amine.
| Compound Name | (2Z,4E)-5-[4-(2-amino-3-fluoro-1-methoxypropyl)phenyl]-N-methoxyocta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 142457099 |
| Molecular Formula | C19H29FN2O2 |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | (2Z,4E)-5-[4-(2-amino-3-fluoro-1-methoxypropyl)phenyl]-N-methoxyocta-2,4-dien-2-amine |
| SMILES | CCC/C(=C\C=C(\C)NOC)c1ccc(C(OC)C(N)CF)cc1 |
| InChI | InChI=1S/C19H29FN2O2/c1-5-6-15(8-7-14(2)22-24-4)16-9-11-17(12-10-16)19(23-3)18(21)13-20/h7-12,18-19,22H,5-6,13,21H2,1-4H3/b14-7-,15-8+ |
| InChIKey | PRHQISRFKQZCPH-UFSWOOAPSA-N |
| XLogP | 3.91 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|