C18H27FN2O2 — CID 142457107
N-[(2Z,4E)-5-[4-(2-amino-3-fluoro-1-methoxypropyl)phenyl]octa-2,4-dien-2-yl]hydroxylamine (PubChem CID 142457107) has the molecular formula C18H27FN2O2 and a molecular weight of 322.42 g/mol. Its IUPAC name is N-[(2Z,4E)-5-[4-(2-amino-3-fluoro-1-methoxypropyl)phenyl]octa-2,4-dien-2-yl]hydroxylamine.
| Compound Name | N-[(2Z,4E)-5-[4-(2-amino-3-fluoro-1-methoxypropyl)phenyl]octa-2,4-dien-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 142457107 |
| Molecular Formula | C18H27FN2O2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | N-[(2Z,4E)-5-[4-(2-amino-3-fluoro-1-methoxypropyl)phenyl]octa-2,4-dien-2-yl]hydroxylamine |
| SMILES | CCC/C(=C\C=C(\C)NO)c1ccc(C(OC)C(N)CF)cc1 |
| InChI | InChI=1S/C18H27FN2O2/c1-4-5-14(7-6-13(2)21-22)15-8-10-16(11-9-15)18(23-3)17(20)12-19/h6-11,17-18,21-22H,4-5,12,20H2,1-3H3/b13-6-,14-7+ |
| InChIKey | FVAXAFCZBWBVJF-SBLPDQQFSA-N |
| XLogP | 3.74 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|