C5H12N2O — CID 142457122
(Z)-3-ethoxyprop-1-ene-1,2-diamine (PubChem CID 142457122) has the molecular formula C5H12N2O and a molecular weight of 116.16 g/mol. Its IUPAC name is (Z)-3-ethoxyprop-1-ene-1,2-diamine.
| Compound Name | (Z)-3-ethoxyprop-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 142457122 |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.09 |
| IUPAC Name | (Z)-3-ethoxyprop-1-ene-1,2-diamine |
| SMILES | CCOC/C(N)=C/N |
| InChI | InChI=1S/C5H12N2O/c1-2-8-4-5(7)3-6/h3H,2,4,6-7H2,1H3/b5-3- |
| InChIKey | XDWWBTOLZFQFQM-HYXAFXHYSA-N |
| XLogP | -0.22 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |