C38H60O6 — CID 142457228
2-(10-methoxydecyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione;2-(8-methoxyoctyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 142457228) has the molecular formula C38H60O6 and a molecular weight of 612.89 g/mol. Its IUPAC name is 2-(10-methoxydecyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione;2-(8-methoxyoctyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(10-methoxydecyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione;2-(8-methoxyoctyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 142457228 |
| Molecular Formula | C38H60O6 |
| Molecular Weight | 612.89 g/mol |
| Exact Mass | 612.44 |
| IUPAC Name | 2-(10-methoxydecyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione;2-(8-methoxyoctyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | COCCCCCCCCC1=C(C)C(=O)C(C)=C(C)C1=O.COCCCCCCCCCCC1=C(C)C(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C20H32O3.C18H28O3/c1-15-16(2)20(22)18(17(3)19(15)21)13-11-9-7-5-6-8-10-12-14-23-4;1-13-14(2)18(20)16(15(3)17(13)19)11-9-7-5-6-8-10-12-21-4/h5-14H2,1-4H3;5-12H2,1-4H3 |
| InChIKey | JATRBCUEETZKGZ-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.89 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|