C27H45N5O4 — CID 142457279
3-[2-[3-[4-[(2,3-diaminoquinolin-4-yl)-pentylamino]butyl-methylamino]propoxy]ethoxy]propanoic acid (PubChem CID 142457279) has the molecular formula C27H45N5O4 and a molecular weight of 503.69 g/mol. Its IUPAC name is 3-[2-[3-[4-[(2,3-diaminoquinolin-4-yl)-pentylamino]butyl-methylamino]propoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[3-[4-[(2,3-diaminoquinolin-4-yl)-pentylamino]butyl-methylamino]propoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 142457279 |
| Molecular Formula | C27H45N5O4 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.35 |
| IUPAC Name | 3-[2-[3-[4-[(2,3-diaminoquinolin-4-yl)-pentylamino]butyl-methylamino]propoxy]ethoxy]propanoic acid |
| SMILES | CCCCCN(CCCCN(C)CCCOCCOCCC(=O)O)c1c(N)c(N)nc2ccccc12 |
| InChI | InChI=1S/C27H45N5O4/c1-3-4-7-16-32(26-22-11-5-6-12-23(22)30-27(29)25(26)28)17-9-8-14-31(2)15-10-18-35-20-21-36-19-13-24(33)34/h5-6,11-12H,3-4,7-10,13-21,28H2,1-2H3,(H2,29,30)(H,33,34) |
| InChIKey | BOIOAIVQODSEQT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|